C7H6Cl2O — CID 71751981
dideuterio-(2,4-dichlorophenyl)methanol (PubChem CID 71751981) has the molecular formula C7H6Cl2O and a molecular weight of 179.04 g/mol. Its IUPAC name is dideuterio-(2,4-dichlorophenyl)methanol.
| Compound Name | dideuterio-(2,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 71751981 |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 179.04 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | dideuterio-(2,4-dichlorophenyl)methanol |
| SMILES | [2H]C([2H])(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2/i4D2 |
| InChIKey | DBHODFSFBXJZNY-APZFVMQVSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.04 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |