C7H7Cl2P — CID 134447961
(2,4-dichlorophenyl)methylphosphane (PubChem CID 134447961) has the molecular formula C7H7Cl2P and a molecular weight of 193.01 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methylphosphane.
| Compound Name | (2,4-dichlorophenyl)methylphosphane |
|---|---|
| PubChem CID | 134447961 |
| Molecular Formula | C7H7Cl2P |
| Molecular Weight | 193.01 g/mol |
| Exact Mass | 191.97 |
| IUPAC Name | (2,4-dichlorophenyl)methylphosphane |
| SMILES | PCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H7Cl2P/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2 |
| InChIKey | CWOIWRJEUFSFHZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.01 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|