C10H15Cl2N — CID 142839755
1-(2,4-dichlorophenyl)-N-methylmethanamine;ethane (PubChem CID 142839755) has the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-methylmethanamine;ethane.
| Compound Name | 1-(2,4-dichlorophenyl)-N-methylmethanamine;ethane |
|---|---|
| PubChem CID | 142839755 |
| Molecular Formula | C10H15Cl2N |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-methylmethanamine;ethane |
| SMILES | CC.CNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl2N.C2H6/c1-11-5-6-2-3-7(9)4-8(6)10;1-2/h2-4,11H,5H2,1H3;1-2H3 |
| InChIKey | ZIXRGHFMHDYIED-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |