C8H7Cl2NS — CID 58279654
N-[(2,4-dichlorophenyl)methyl]methanethioamide (PubChem CID 58279654) has the molecular formula C8H7Cl2NS and a molecular weight of 220.12 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]methanethioamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]methanethioamide |
|---|---|
| PubChem CID | 58279654 |
| Molecular Formula | C8H7Cl2NS |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 218.97 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]methanethioamide |
| SMILES | S=CNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl2NS/c9-7-2-1-6(4-11-5-12)8(10)3-7/h1-3,5H,4H2,(H,11,12) |
| InChIKey | ZBWHVEGXMFXBPW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|