C14H17Cl2N — CID 88713574
N-[(2,4-dichlorophenyl)methyl]hepta-1,6-dien-4-amine (PubChem CID 88713574) has the molecular formula C14H17Cl2N and a molecular weight of 270.20 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]hepta-1,6-dien-4-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]hepta-1,6-dien-4-amine |
|---|---|
| PubChem CID | 88713574 |
| Molecular Formula | C14H17Cl2N |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]hepta-1,6-dien-4-amine |
| SMILES | C=CCC(CC=C)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N/c1-3-5-13(6-4-2)17-10-11-7-8-12(15)9-14(11)16/h3-4,7-9,13,17H,1-2,5-6,10H2 |
| InChIKey | VEHCJUIYRJXNPU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|