C12H15Cl2N — CID 116660621
1-(2,5-dichlorophenyl)-N-methylpent-4-en-2-amine (PubChem CID 116660621) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-N-methylpent-4-en-2-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-N-methylpent-4-en-2-amine |
|---|---|
| PubChem CID | 116660621 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-N-methylpent-4-en-2-amine |
| SMILES | C=CCC(Cc1cc(Cl)ccc1Cl)NC |
| InChI | InChI=1S/C12H15Cl2N/c1-3-4-11(15-2)8-9-7-10(13)5-6-12(9)14/h3,5-7,11,15H,1,4,8H2,2H3 |
| InChIKey | VBNLIBFMZIDNMR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|