C9H11Cl2NS — CID 143498139
1-[(2,4-dichlorophenyl)methylamino]ethanethiol (PubChem CID 143498139) has the molecular formula C9H11Cl2NS and a molecular weight of 236.17 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methylamino]ethanethiol.
| Compound Name | 1-[(2,4-dichlorophenyl)methylamino]ethanethiol |
|---|---|
| PubChem CID | 143498139 |
| Molecular Formula | C9H11Cl2NS |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methylamino]ethanethiol |
| SMILES | CC(S)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2NS/c1-6(13)12-5-7-2-3-8(10)4-9(7)11/h2-4,6,12-13H,5H2,1H3 |
| InChIKey | UPBUHQYVLVUWMF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|