C12H15ClFN — CID 115762436
N-[(5-chloro-2-fluorophenyl)methyl]pent-4-en-2-amine (PubChem CID 115762436) has the molecular formula C12H15ClFN and a molecular weight of 227.71 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]pent-4-en-2-amine.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 115762436 |
| Molecular Formula | C12H15ClFN |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]pent-4-en-2-amine |
| SMILES | C=CCC(C)NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H15ClFN/c1-3-4-9(2)15-8-10-7-11(13)5-6-12(10)14/h3,5-7,9,15H,1,4,8H2,2H3 |
| InChIKey | PKCGHBCSRMGIEU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|