C11H12ClFN2 — CID 104586886
3-[(5-chloro-2-fluorophenyl)methylamino]butanenitrile (PubChem CID 104586886) has the molecular formula C11H12ClFN2 and a molecular weight of 226.68 g/mol. Its IUPAC name is 3-[(5-chloro-2-fluorophenyl)methylamino]butanenitrile.
| Compound Name | 3-[(5-chloro-2-fluorophenyl)methylamino]butanenitrile |
|---|---|
| PubChem CID | 104586886 |
| Molecular Formula | C11H12ClFN2 |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-[(5-chloro-2-fluorophenyl)methylamino]butanenitrile |
| SMILES | CC(CC#N)NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H12ClFN2/c1-8(4-5-14)15-7-9-6-10(12)2-3-11(9)13/h2-3,6,8,15H,4,7H2,1H3 |
| InChIKey | GVXLHCURZUZKTK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |