C8H6Cl2O — CID 15948879
2-(2,4-dichlorophenyl)acetaldehyde (PubChem CID 15948879) has the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)acetaldehyde.
| Compound Name | 2-(2,4-dichlorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 15948879 |
| Molecular Formula | C8H6Cl2O |
| Molecular Weight | 189.04 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | 2-(2,4-dichlorophenyl)acetaldehyde |
| SMILES | O=CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,4-5H,3H2 |
| InChIKey | MMJDYUOVXFOHQH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.04 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|