C8H7Cl2NO2 — CID 19046665
N-[(2,4-dichlorophenyl)methoxy]formamide (PubChem CID 19046665) has the molecular formula C8H7Cl2NO2 and a molecular weight of 220.06 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methoxy]formamide.
| Compound Name | N-[(2,4-dichlorophenyl)methoxy]formamide |
|---|---|
| PubChem CID | 19046665 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methoxy]formamide |
| SMILES | O=CNOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl2NO2/c9-7-2-1-6(8(10)3-7)4-13-11-5-12/h1-3,5H,4H2,(H,11,12) |
| InChIKey | VIEQVTRRSLHTSH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|