C9H9Cl2N3O3 — CID 135716779
1-[(2,4-dichlorophenyl)methoxy]-3-[(E)-hydroxyiminomethyl]urea (PubChem CID 135716779) has the molecular formula C9H9Cl2N3O3 and a molecular weight of 278.10 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methoxy]-3-[(E)-hydroxyiminomethyl]urea.
| Compound Name | 1-[(2,4-dichlorophenyl)methoxy]-3-[(E)-hydroxyiminomethyl]urea |
|---|---|
| PubChem CID | 135716779 |
| Molecular Formula | C9H9Cl2N3O3 |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methoxy]-3-[(E)-hydroxyiminomethyl]urea |
| SMILES | O=C(N/C=N/O)NOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O3/c10-7-2-1-6(8(11)3-7)4-17-14-9(15)12-5-13-16/h1-3,5,16H,4H2,(H2,12,13,14,15) |
| InChIKey | INYLKSIJMGWQKT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|