C11H12Cl2N2O3 — CID 2375336
(2,4-dichlorophenyl)methyl (2R)-2-(carbamoylamino)propanoate (PubChem CID 2375336) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl (2R)-2-(carbamoylamino)propanoate.
| Compound Name | (2,4-dichlorophenyl)methyl (2R)-2-(carbamoylamino)propanoate |
|---|---|
| PubChem CID | 2375336 |
| Molecular Formula | C11H12Cl2N2O3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | (2,4-dichlorophenyl)methyl (2R)-2-(carbamoylamino)propanoate |
| SMILES | C[C@@H](NC(N)=O)C(=O)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3/c1-6(15-11(14)17)10(16)18-5-7-2-3-8(12)4-9(7)13/h2-4,6H,5H2,1H3,(H3,14,15,17)/t6-/m1/s1 |
| InChIKey | JSZYHVITVKTHGK-ZCFIWIBFSA-N |
| XLogP | 2.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |