C18H17Cl2NO4 — CID 8842112
(2,4-dichlorophenyl)methyl (2S)-2-[(2-phenoxyacetyl)amino]propanoate (PubChem CID 8842112) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl (2S)-2-[(2-phenoxyacetyl)amino]propanoate.
| Compound Name | (2,4-dichlorophenyl)methyl (2S)-2-[(2-phenoxyacetyl)amino]propanoate |
|---|---|
| PubChem CID | 8842112 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | (2,4-dichlorophenyl)methyl (2S)-2-[(2-phenoxyacetyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)COc1ccccc1)C(=O)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2NO4/c1-12(21-17(22)11-24-15-5-3-2-4-6-15)18(23)25-10-13-7-8-14(19)9-16(13)20/h2-9,12H,10-11H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | BBFIPNPYUKLIOJ-LBPRGKRZSA-N |
| XLogP | 3.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |