C16H13Cl2NO4 — CID 146175960
[[2-(2,4-dichlorophenyl)acetyl]amino] 2-phenoxyacetate (PubChem CID 146175960) has the molecular formula C16H13Cl2NO4 and a molecular weight of 354.19 g/mol. Its IUPAC name is [[2-(2,4-dichlorophenyl)acetyl]amino] 2-phenoxyacetate.
| Compound Name | [[2-(2,4-dichlorophenyl)acetyl]amino] 2-phenoxyacetate |
|---|---|
| PubChem CID | 146175960 |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | [[2-(2,4-dichlorophenyl)acetyl]amino] 2-phenoxyacetate |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NOC(=O)COc1ccccc1 |
| InChI | InChI=1S/C16H13Cl2NO4/c17-12-7-6-11(14(18)9-12)8-15(20)19-23-16(21)10-22-13-4-2-1-3-5-13/h1-7,9H,8,10H2,(H,19,20) |
| InChIKey | OTPIYJGCNSYLIL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|