C15H13Cl2NO3 — CID 61321528
(2,4-dichlorophenyl)methyl 2-(3-aminophenoxy)acetate (PubChem CID 61321528) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2-(3-aminophenoxy)acetate.
| Compound Name | (2,4-dichlorophenyl)methyl 2-(3-aminophenoxy)acetate |
|---|---|
| PubChem CID | 61321528 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 2-(3-aminophenoxy)acetate |
| SMILES | Nc1cccc(OCC(=O)OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO3/c16-11-5-4-10(14(17)6-11)8-21-15(19)9-20-13-3-1-2-12(18)7-13/h1-7H,8-9,18H2 |
| InChIKey | UBSWNOKUXQXRSQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|