C18H18Cl2O4 — CID 123685242
methyl 4-[3-[(2,4-dichlorophenyl)methoxy]phenoxy]butanoate (PubChem CID 123685242) has the molecular formula C18H18Cl2O4 and a molecular weight of 369.24 g/mol. Its IUPAC name is methyl 4-[3-[(2,4-dichlorophenyl)methoxy]phenoxy]butanoate.
| Compound Name | methyl 4-[3-[(2,4-dichlorophenyl)methoxy]phenoxy]butanoate |
|---|---|
| PubChem CID | 123685242 |
| Molecular Formula | C18H18Cl2O4 |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | methyl 4-[3-[(2,4-dichlorophenyl)methoxy]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2O4/c1-22-18(21)6-3-9-23-15-4-2-5-16(11-15)24-12-13-7-8-14(19)10-17(13)20/h2,4-5,7-8,10-11H,3,6,9,12H2,1H3 |
| InChIKey | ABRNZBGBMWGFSO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|