C14H16N2O4 — CID 8842803
[(1S)-1-cyanoethyl] (2S)-2-[(2-phenoxyacetyl)amino]propanoate (PubChem CID 8842803) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] (2S)-2-[(2-phenoxyacetyl)amino]propanoate.
| Compound Name | [(1S)-1-cyanoethyl] (2S)-2-[(2-phenoxyacetyl)amino]propanoate |
|---|---|
| PubChem CID | 8842803 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [(1S)-1-cyanoethyl] (2S)-2-[(2-phenoxyacetyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)COc1ccccc1)C(=O)O[C@@H](C)C#N |
| InChI | InChI=1S/C14H16N2O4/c1-10(8-15)20-14(18)11(2)16-13(17)9-19-12-6-4-3-5-7-12/h3-7,10-11H,9H2,1-2H3,(H,16,17)/t10-,11-/m0/s1 |
| InChIKey | BTHGOUIGUXMKBT-QWRGUYRKSA-N |
| XLogP | 1.03 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |