C21H14Cl4O3 — CID 4767083
2,4-bis[(2,4-dichlorophenyl)methoxy]benzaldehyde (PubChem CID 4767083) has the molecular formula C21H14Cl4O3 and a molecular weight of 456.15 g/mol. Its IUPAC name is 2,4-bis[(2,4-dichlorophenyl)methoxy]benzaldehyde.
| Compound Name | 2,4-bis[(2,4-dichlorophenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 4767083 |
| Molecular Formula | C21H14Cl4O3 |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 2,4-bis[(2,4-dichlorophenyl)methoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCc2ccc(Cl)cc2Cl)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H14Cl4O3/c22-16-4-1-14(19(24)7-16)11-27-18-6-3-13(10-26)21(9-18)28-12-15-2-5-17(23)8-20(15)25/h1-10H,11-12H2 |
| InChIKey | AGWHUEYGCZUXON-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|