C13H11Cl2NO — CID 11579870
4-[(2,4-dichlorophenyl)methoxy]aniline (PubChem CID 11579870) has the molecular formula C13H11Cl2NO and a molecular weight of 268.14 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]aniline.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]aniline |
|---|---|
| PubChem CID | 11579870 |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]aniline |
| SMILES | Nc1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H11Cl2NO/c14-10-2-1-9(13(15)7-10)8-17-12-5-3-11(16)4-6-12/h1-7H,8,16H2 |
| InChIKey | HRFQDYIICCKGEN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|