C17H18Cl2O — CID 60627955
1-[(4-tert-butylphenoxy)methyl]-2,4-dichlorobenzene (PubChem CID 60627955) has the molecular formula C17H18Cl2O and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-[(4-tert-butylphenoxy)methyl]-2,4-dichlorobenzene.
| Compound Name | 1-[(4-tert-butylphenoxy)methyl]-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 60627955 |
| Molecular Formula | C17H18Cl2O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-[(4-tert-butylphenoxy)methyl]-2,4-dichlorobenzene |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2O/c1-17(2,3)13-5-8-15(9-6-13)20-11-12-4-7-14(18)10-16(12)19/h4-10H,11H2,1-3H3 |
| InChIKey | RTFZOMHFZAQLTM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |