C18H12Cl2O3 — CID 169334376
5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]furan-2-carbaldehyde (PubChem CID 169334376) has the molecular formula C18H12Cl2O3 and a molecular weight of 347.20 g/mol. Its IUPAC name is 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334376 |
| Molecular Formula | C18H12Cl2O3 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 5-[4-[(2,4-dichlorophenyl)methoxy]phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(OCc3ccc(Cl)cc3Cl)cc2)o1 |
| InChI | InChI=1S/C18H12Cl2O3/c19-14-4-1-13(17(20)9-14)11-22-15-5-2-12(3-6-15)18-8-7-16(10-21)23-18/h1-10H,11H2 |
| InChIKey | ROROFOYYEPZXQY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|