C27H20Cl2N2O4 — CID 19657640
N-[(E)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide (PubChem CID 19657640) has the molecular formula C27H20Cl2N2O4 and a molecular weight of 507.37 g/mol. Its IUPAC name is N-[(E)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide.
| Compound Name | N-[(E)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 19657640 |
| Molecular Formula | C27H20Cl2N2O4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-[(E)-[5-(4-acetylphenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide |
| SMILES | CC(=O)c1ccc(-c2ccc(/C=N/NC(=O)c3ccccc3OCc3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C27H20Cl2N2O4/c1-17(32)18-6-8-19(9-7-18)25-13-12-22(35-25)15-30-31-27(33)23-4-2-3-5-26(23)34-16-20-10-11-21(28)14-24(20)29/h2-15H,16H2,1H3,(H,31,33)/b30-15+ |
| InChIKey | VAOJVDYPYLQOOH-FJEPWZHXSA-N |
| XLogP | 6.80 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|