C16H13Cl4NO2 — CID 15111116
N-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]formamide (PubChem CID 15111116) has the molecular formula C16H13Cl4NO2 and a molecular weight of 393.10 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]formamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]formamide |
|---|---|
| PubChem CID | 15111116 |
| Molecular Formula | C16H13Cl4NO2 |
| Molecular Weight | 393.10 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]formamide |
| SMILES | O=CNCC(OCc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl4NO2/c17-11-2-1-10(14(19)5-11)8-23-16(7-21-9-22)13-4-3-12(18)6-15(13)20/h1-6,9,16H,7-8H2,(H,21,22) |
| InChIKey | FNCVZCLFBSGWSC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.10 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|