C9H8Cl2O2 — CID 114795177
3-(2,4-dichlorophenyl)-3-hydroxypropanal (PubChem CID 114795177) has the molecular formula C9H8Cl2O2 and a molecular weight of 219.07 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-3-hydroxypropanal.
| Compound Name | 3-(2,4-dichlorophenyl)-3-hydroxypropanal |
|---|---|
| PubChem CID | 114795177 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-3-hydroxypropanal |
| SMILES | O=CCC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O2/c10-6-1-2-7(8(11)5-6)9(13)3-4-12/h1-2,4-5,9,13H,3H2 |
| InChIKey | HROPOATVDWGAKK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|