C8H8Cl2OS — CID 116830061
1-(2,4-dichlorophenyl)-2-sulfanylethanol (PubChem CID 116830061) has the molecular formula C8H8Cl2OS and a molecular weight of 223.12 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-sulfanylethanol.
| Compound Name | 1-(2,4-dichlorophenyl)-2-sulfanylethanol |
|---|---|
| PubChem CID | 116830061 |
| Molecular Formula | C8H8Cl2OS |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-sulfanylethanol |
| SMILES | OC(CS)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2OS/c9-5-1-2-6(7(10)3-5)8(11)4-12/h1-3,8,11-12H,4H2 |
| InChIKey | QQGDRLCCGMUIQZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|