C13H8Cl4O — CID 63427541
(2,4-dichlorophenyl)-(3,5-dichlorophenyl)methanol (PubChem CID 63427541) has the molecular formula C13H8Cl4O and a molecular weight of 322.02 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(3,5-dichlorophenyl)methanol.
| Compound Name | (2,4-dichlorophenyl)-(3,5-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 63427541 |
| Molecular Formula | C13H8Cl4O |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | (2,4-dichlorophenyl)-(3,5-dichlorophenyl)methanol |
| SMILES | OC(c1cc(Cl)cc(Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl4O/c14-8-1-2-11(12(17)6-8)13(18)7-3-9(15)5-10(16)4-7/h1-6,13,18H |
| InChIKey | KKAKQWYIGGNQJB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |