C12H14Cl2O3 — CID 62942590
5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid (PubChem CID 62942590) has the molecular formula C12H14Cl2O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid.
| Compound Name | 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid |
|---|---|
| PubChem CID | 62942590 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid |
| SMILES | CC(CC(=O)O)CC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O3/c1-7(5-12(16)17)4-11(15)9-3-2-8(13)6-10(9)14/h2-3,6-7,11,15H,4-5H2,1H3,(H,16,17) |
| InChIKey | PPYCJIQZWAXPCJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |