5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid

C12H14Cl2O3 — CID 62942590

IUPAC5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid
SMILESCC(CC(=O)O)CC(O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H14Cl2O3/c1-7(5-12(16)17)4-11(15)9-3-2-8(13)6-10(9)14/h2-3,6-7,11,15H,4-5H2,1H3,(H,16,17)
InChIKeyPPYCJIQZWAXPCJ-UHFFFAOYSA-N
MW277.15 g/mol
LogP3.53
Rot. Bonds5

About 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid

5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid (PubChem CID 62942590) has the molecular formula C12H14Cl2O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid.

Molecular Properties

Compound Name5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid
PubChem CID62942590
Molecular FormulaC12H14Cl2O3
Molecular Weight277.15 g/mol
Exact Mass276.03
IUPAC Name5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid
SMILESCC(CC(=O)O)CC(O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H14Cl2O3/c1-7(5-12(16)17)4-11(15)9-3-2-8(13)6-10(9)14/h2-3,6-7,11,15H,4-5H2,1H3,(H,16,17)
InChIKeyPPYCJIQZWAXPCJ-UHFFFAOYSA-N
XLogP3.53
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.15
LogP ≤ 53.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid?
The IUPAC name of 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid (CID 62942590) is 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid?
The canonical SMILES for 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid is CC(CC(=O)O)CC(O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid?
The InChIKey is PPYCJIQZWAXPCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2O3/c1-7(5-12(16)17)4-11(15)9-3-2-8(13)6-10(9)14/h2-3,6-7,11,15H,4-5H2,1H3,(H,16,17).
What are the key properties of 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid?
5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid has a molecular weight of 277.15 g/mol, XLogP of 3.53, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-5-hydroxy-3-methylpentanoic acid is sourced from PubChem (CID 62942590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).