C12H12Cl2O4 — CID 134105150
methyl (Z)-5-(2,4-dichlorophenyl)-3,5-dihydroxypent-2-enoate (PubChem CID 134105150) has the molecular formula C12H12Cl2O4 and a molecular weight of 291.13 g/mol. Its IUPAC name is methyl (Z)-5-(2,4-dichlorophenyl)-3,5-dihydroxypent-2-enoate.
| Compound Name | methyl (Z)-5-(2,4-dichlorophenyl)-3,5-dihydroxypent-2-enoate |
|---|---|
| PubChem CID | 134105150 |
| Molecular Formula | C12H12Cl2O4 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | methyl (Z)-5-(2,4-dichlorophenyl)-3,5-dihydroxypent-2-enoate |
| SMILES | COC(=O)/C=C(\O)CC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2O4/c1-18-12(17)6-8(15)5-11(16)9-3-2-7(13)4-10(9)14/h2-4,6,11,15-16H,5H2,1H3/b8-6- |
| InChIKey | UNVRGAWOPAARQY-VURMDHGXSA-N |
| XLogP | 3.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|