C13H17Cl2NO2 — CID 43536724
methyl 3-[1-(2,4-dichlorophenyl)ethylamino]butanoate (PubChem CID 43536724) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is methyl 3-[1-(2,4-dichlorophenyl)ethylamino]butanoate.
| Compound Name | methyl 3-[1-(2,4-dichlorophenyl)ethylamino]butanoate |
|---|---|
| PubChem CID | 43536724 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | methyl 3-[1-(2,4-dichlorophenyl)ethylamino]butanoate |
| SMILES | COC(=O)CC(C)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2/c1-8(6-13(17)18-3)16-9(2)11-5-4-10(14)7-12(11)15/h4-5,7-9,16H,6H2,1-3H3 |
| InChIKey | BLDPLKSTXQVLFK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |