C16H24Cl2N2O — CID 43112445
2-[1-(2,4-dichlorophenyl)ethylamino]-N-pentan-3-ylpropanamide (PubChem CID 43112445) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)ethylamino]-N-pentan-3-ylpropanamide.
| Compound Name | 2-[1-(2,4-dichlorophenyl)ethylamino]-N-pentan-3-ylpropanamide |
|---|---|
| PubChem CID | 43112445 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)ethylamino]-N-pentan-3-ylpropanamide |
| SMILES | CCC(CC)NC(=O)C(C)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2N2O/c1-5-13(6-2)20-16(21)11(4)19-10(3)14-8-7-12(17)9-15(14)18/h7-11,13,19H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | GYPUMALBJUMSAB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |