C14H16Cl2N2O — CID 43112448
2-[1-(2,4-dichlorophenyl)ethylamino]-N-prop-2-ynylpropanamide (PubChem CID 43112448) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)ethylamino]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[1-(2,4-dichlorophenyl)ethylamino]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 43112448 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)ethylamino]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O/c1-4-7-17-14(19)10(3)18-9(2)12-6-5-11(15)8-13(12)16/h1,5-6,8-10,18H,7H2,2-3H3,(H,17,19) |
| InChIKey | IVDVBDGMQKAGAG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|