C14H14Cl2N2O3 — CID 110017546
N'-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-N-prop-2-ynylpropanediamide (PubChem CID 110017546) has the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.18 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-N-prop-2-ynylpropanediamide.
| Compound Name | N'-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-N-prop-2-ynylpropanediamide |
|---|---|
| PubChem CID | 110017546 |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N'-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-N-prop-2-ynylpropanediamide |
| SMILES | C#CCNC(=O)CC(=O)NCC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O3/c1-2-5-17-13(20)7-14(21)18-8-12(19)10-4-3-9(15)6-11(10)16/h1,3-4,6,12,19H,5,7-8H2,(H,17,20)(H,18,21) |
| InChIKey | JABSSHRBOVTNIE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|