C14H19Cl2NO2 — CID 111115633
N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3,3-dimethylbutanamide (PubChem CID 111115633) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 111115633 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2/c1-14(2,3)7-13(19)17-8-12(18)10-5-4-9(15)6-11(10)16/h4-6,12,18H,7-8H2,1-3H3,(H,17,19) |
| InChIKey | CAUKYKKMUOLSAO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |