C15H22ClNO2 — CID 111450920
N-[2-(2-chlorophenyl)-2-hydroxyethyl]-4,4-dimethylpentanamide (PubChem CID 111450920) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-hydroxyethyl]-4,4-dimethylpentanamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-hydroxyethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 111450920 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-hydroxyethyl]-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CCC(=O)NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C15H22ClNO2/c1-15(2,3)9-8-14(19)17-10-13(18)11-6-4-5-7-12(11)16/h4-7,13,18H,8-10H2,1-3H3,(H,17,19) |
| InChIKey | INIJNECWFXZBKZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |