C16H16Cl2N2O2 — CID 96517114
N-[(2S)-2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-pyridin-2-ylpropanamide (PubChem CID 96517114) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is N-[(2S)-2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-pyridin-2-ylpropanamide.
| Compound Name | N-[(2S)-2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 96517114 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[(2S)-2-(2,4-dichlorophenyl)-2-hydroxyethyl]-3-pyridin-2-ylpropanamide |
| SMILES | O=C(CCc1ccccn1)NC[C@@H](O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O2/c17-11-4-6-13(14(18)9-11)15(21)10-20-16(22)7-5-12-3-1-2-8-19-12/h1-4,6,8-9,15,21H,5,7,10H2,(H,20,22)/t15-/m1/s1 |
| InChIKey | HEJDHGREJRKEKM-OAHLLOKOSA-N |
| XLogP | 3.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |