C16H12Cl2N2O2 — CID 111831116
2-cyano-N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]benzamide (PubChem CID 111831116) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 2-cyano-N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]benzamide.
| Compound Name | 2-cyano-N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 111831116 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-cyano-N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]benzamide |
| SMILES | N#Cc1ccccc1C(=O)NCC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-11-5-6-13(14(18)7-11)15(21)9-20-16(22)12-4-2-1-3-10(12)8-19/h1-7,15,21H,9H2,(H,20,22) |
| InChIKey | HNFZILBMSNVZOX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |