C27H22Cl2GeO2 — CID 15180323
3-(2,4-dichlorophenyl)-3-triphenylgermylpropanoic acid (PubChem CID 15180323) has the molecular formula C27H22Cl2GeO2 and a molecular weight of 521.99 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-3-triphenylgermylpropanoic acid.
| Compound Name | 3-(2,4-dichlorophenyl)-3-triphenylgermylpropanoic acid |
|---|---|
| PubChem CID | 15180323 |
| Molecular Formula | C27H22Cl2GeO2 |
| Molecular Weight | 521.99 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-3-triphenylgermylpropanoic acid |
| SMILES | O=C(O)CC(c1ccc(Cl)cc1Cl)[Ge](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22Cl2GeO2/c28-20-16-17-24(25(29)18-20)26(19-27(31)32)30(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-18,26H,19H2,(H,31,32) |
| InChIKey | UMTSVBNXDDHERB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |