C17H17Cl2N3O2 — CID 25483366
N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(phenylcarbamoylamino)acetamide (PubChem CID 25483366) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(phenylcarbamoylamino)acetamide.
| Compound Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(phenylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 25483366 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-(phenylcarbamoylamino)acetamide |
| SMILES | C[C@H](NC(=O)CNC(=O)Nc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-11(14-8-7-12(18)9-15(14)19)21-16(23)10-20-17(24)22-13-5-3-2-4-6-13/h2-9,11H,10H2,1H3,(H,21,23)(H2,20,22,24)/t11-/m0/s1 |
| InChIKey | CEZRUVWBGQCBDE-NSHDSACASA-N |
| XLogP | 3.99 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |