C12H14Cl2N2O3 — CID 61184371
3-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid (PubChem CID 61184371) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 3-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid.
| Compound Name | 3-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 61184371 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]propanoic acid |
| SMILES | CC(NC(=O)NCCC(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-7(9-3-2-8(13)6-10(9)14)16-12(19)15-5-4-11(17)18/h2-3,6-7H,4-5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | KDNCHJRDJQINQO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |