C19H16Cl2N2O — CID 17181566
1-[1-(2,4-dichlorophenyl)ethyl]-3-naphthalen-1-ylurea (PubChem CID 17181566) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 17181566 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-naphthalen-1-ylurea |
| SMILES | CC(NC(=O)Nc1cccc2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O/c1-12(15-10-9-14(20)11-17(15)21)22-19(24)23-18-8-4-6-13-5-2-3-7-16(13)18/h2-12H,1H3,(H2,22,23,24) |
| InChIKey | BNHMYEDJUWNBFA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |