C13H16Cl2N2O4 — CID 61184551
2-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]-3-hydroxybutanoic acid (PubChem CID 61184551) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61184551 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)ethylcarbamoylamino]-3-hydroxybutanoic acid |
| SMILES | CC(NC(=O)NC(C(=O)O)C(C)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-6(9-4-3-8(14)5-10(9)15)16-13(21)17-11(7(2)18)12(19)20/h3-7,11,18H,1-2H3,(H,19,20)(H2,16,17,21) |
| InChIKey | MEKXHZDNCBQKJP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |