C10H7Cl2NO2 — CID 92982599
(3R)-3-cyano-3-(2,4-dichlorophenyl)propanoic acid (PubChem CID 92982599) has the molecular formula C10H7Cl2NO2 and a molecular weight of 244.08 g/mol. Its IUPAC name is (3R)-3-cyano-3-(2,4-dichlorophenyl)propanoic acid.
| Compound Name | (3R)-3-cyano-3-(2,4-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 92982599 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | (3R)-3-cyano-3-(2,4-dichlorophenyl)propanoic acid |
| SMILES | N#C[C@H](CC(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NO2/c11-7-1-2-8(9(12)4-7)6(5-13)3-10(14)15/h1-2,4,6H,3H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | YPWDURPSIHDKSW-LURJTMIESA-N |
| XLogP | 3.08 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |