C17H15Cl2N — CID 82137198
2-(2,4-dichlorophenyl)-5-phenylpentanenitrile (PubChem CID 82137198) has the molecular formula C17H15Cl2N and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-phenylpentanenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-5-phenylpentanenitrile |
|---|---|
| PubChem CID | 82137198 |
| Molecular Formula | C17H15Cl2N |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-phenylpentanenitrile |
| SMILES | N#CC(CCCc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N/c18-15-9-10-16(17(19)11-15)14(12-20)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-11,14H,4,7-8H2 |
| InChIKey | VVFMUCBPQDLQKB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |