C17H14BrCl2NO — CID 129362493
(2S)-5-(2-bromophenoxy)-2-(2,4-dichlorophenyl)pentanenitrile (PubChem CID 129362493) has the molecular formula C17H14BrCl2NO and a molecular weight of 399.12 g/mol. Its IUPAC name is (2S)-5-(2-bromophenoxy)-2-(2,4-dichlorophenyl)pentanenitrile.
| Compound Name | (2S)-5-(2-bromophenoxy)-2-(2,4-dichlorophenyl)pentanenitrile |
|---|---|
| PubChem CID | 129362493 |
| Molecular Formula | C17H14BrCl2NO |
| Molecular Weight | 399.12 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | (2S)-5-(2-bromophenoxy)-2-(2,4-dichlorophenyl)pentanenitrile |
| SMILES | N#C[C@@H](CCCOc1ccccc1Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14BrCl2NO/c18-15-5-1-2-6-17(15)22-9-3-4-12(11-21)14-8-7-13(19)10-16(14)20/h1-2,5-8,10,12H,3-4,9H2/t12-/m1/s1 |
| InChIKey | MQZSQCYXSJBTEP-GFCCVEGCSA-N |
| XLogP | 6.22 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.12 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|