C14H15Cl2NO — CID 114874950
2-(2,4-dichlorophenyl)-5-methyl-3-oxoheptanenitrile (PubChem CID 114874950) has the molecular formula C14H15Cl2NO and a molecular weight of 284.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methyl-3-oxoheptanenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methyl-3-oxoheptanenitrile |
|---|---|
| PubChem CID | 114874950 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methyl-3-oxoheptanenitrile |
| SMILES | CCC(C)CC(=O)C(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2NO/c1-3-9(2)6-14(18)12(8-17)11-5-4-10(15)7-13(11)16/h4-5,7,9,12H,3,6H2,1-2H3 |
| InChIKey | YTIBEVQBNVYXMI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |