C10H8Cl2N2O — CID 83543201
N-[cyano-(2,4-dichlorophenyl)methyl]acetamide (PubChem CID 83543201) has the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. Its IUPAC name is N-[cyano-(2,4-dichlorophenyl)methyl]acetamide.
| Compound Name | N-[cyano-(2,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 83543201 |
| Molecular Formula | C10H8Cl2N2O |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | N-[cyano-(2,4-dichlorophenyl)methyl]acetamide |
| SMILES | CC(=O)NC(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N2O/c1-6(15)14-10(5-13)8-3-2-7(11)4-9(8)12/h2-4,10H,1H3,(H,14,15) |
| InChIKey | IRZIGKUITADDJR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |