C11H10Cl2N2 — CID 43151713
2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetonitrile (PubChem CID 43151713) has the molecular formula C11H10Cl2N2 and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetonitrile.
| Compound Name | 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 43151713 |
| Molecular Formula | C11H10Cl2N2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetonitrile |
| SMILES | N#CC(NC1CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2/c12-7-1-4-9(10(13)5-7)11(6-14)15-8-2-3-8/h1,4-5,8,11,15H,2-3H2 |
| InChIKey | MVFJPGMJJKBGJC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |