C13H16Cl2N2 — CID 82020101
2-(2,4-dichlorophenyl)-2-(3-methylbutylamino)acetonitrile (PubChem CID 82020101) has the molecular formula C13H16Cl2N2 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-(3-methylbutylamino)acetonitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-2-(3-methylbutylamino)acetonitrile |
|---|---|
| PubChem CID | 82020101 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-(3-methylbutylamino)acetonitrile |
| SMILES | CC(C)CCNC(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2/c1-9(2)5-6-17-13(8-16)11-4-3-10(14)7-12(11)15/h3-4,7,9,13,17H,5-6H2,1-2H3 |
| InChIKey | PAHUBFNNWFVJAF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |