C11H11Cl2NO2 — CID 43754588
2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid (PubChem CID 43754588) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid.
| Compound Name | 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid |
|---|---|
| PubChem CID | 43754588 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid |
| SMILES | O=C(O)C(NC1CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO2/c12-6-1-4-8(9(13)5-6)10(11(15)16)14-7-2-3-7/h1,4-5,7,10,14H,2-3H2,(H,15,16) |
| InChIKey | ONXXOIRKDYGBOH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |