2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid

C11H11Cl2NO2 — CID 43754588

IUPAC2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid
SMILESO=C(O)C(NC1CC1)c1ccc(Cl)cc1Cl
InChIInChI=1S/C11H11Cl2NO2/c12-6-1-4-8(9(13)5-6)10(11(15)16)14-7-2-3-7/h1,4-5,7,10,14H,2-3H2,(H,15,16)
InChIKeyONXXOIRKDYGBOH-UHFFFAOYSA-N
MW260.12 g/mol
LogP2.87
Rot. Bonds4

About 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid

2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid (PubChem CID 43754588) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid.

Molecular Properties

Compound Name2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid
PubChem CID43754588
Molecular FormulaC11H11Cl2NO2
Molecular Weight260.12 g/mol
Exact Mass259.02
IUPAC Name2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid
SMILESO=C(O)C(NC1CC1)c1ccc(Cl)cc1Cl
InChIInChI=1S/C11H11Cl2NO2/c12-6-1-4-8(9(13)5-6)10(11(15)16)14-7-2-3-7/h1,4-5,7,10,14H,2-3H2,(H,15,16)
InChIKeyONXXOIRKDYGBOH-UHFFFAOYSA-N
XLogP2.87
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.12
LogP ≤ 52.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid?
The IUPAC name of 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid (CID 43754588) is 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid.
What is the SMILES notation for 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid?
The canonical SMILES for 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid is O=C(O)C(NC1CC1)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid?
The InChIKey is ONXXOIRKDYGBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NO2/c12-6-1-4-8(9(13)5-6)10(11(15)16)14-7-2-3-7/h1,4-5,7,10,14H,2-3H2,(H,15,16).
What are the key properties of 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid?
2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid has a molecular weight of 260.12 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetic acid is sourced from PubChem (CID 43754588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).